Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
2,3-Dimethylbutane, 98+%
CAS: 79-29-8 Molecular Formula: C6H14 Molecular Weight (g/mol): 86.18 MDL Number: MFCD00008925 InChI Key: ZFFMLCVRJBZUDZ-UHFFFAOYSA-N Synonym: diisopropyl,biisopropyl,butane, 2,3-dimethyl,1,1,2,2-tetramethylethane,hsdb 76,unii-68isq7a432,ccris 6020,ch3 2chch ch3 2,acmc-1bmfq,dsstox_cid_5112 PubChem CID: 6589 IUPAC Name: 2,3-dimethylbutane SMILES: CC(C)C(C)C
| PubChem CID | 6589 |
|---|---|
| CAS | 79-29-8 |
| Molecular Weight (g/mol) | 86.18 |
| MDL Number | MFCD00008925 |
| SMILES | CC(C)C(C)C |
| Synonym | diisopropyl,biisopropyl,butane, 2,3-dimethyl,1,1,2,2-tetramethylethane,hsdb 76,unii-68isq7a432,ccris 6020,ch3 2chch ch3 2,acmc-1bmfq,dsstox_cid_5112 |
| IUPAC Name | 2,3-dimethylbutane |
| InChI Key | ZFFMLCVRJBZUDZ-UHFFFAOYSA-N |
| Molecular Formula | C6H14 |
Propylene carbonate, 99%
CAS: 108-32-7 Molecular Formula: C4H6O3 Molecular Weight (g/mol): 102.09 MDL Number: MFCD00005385,MFCD00798264,MFCD00798265 InChI Key: RUOJZAUFBMNUDX-UHFFFAOYNA-N Synonym: propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate PubChem CID: 7924 IUPAC Name: 4-methyl-1,3-dioxolan-2-one SMILES: CC1COC(=O)O1
| PubChem CID | 7924 |
|---|---|
| CAS | 108-32-7 |
| Molecular Weight (g/mol) | 102.09 |
| MDL Number | MFCD00005385,MFCD00798264,MFCD00798265 |
| SMILES | CC1COC(=O)O1 |
| Synonym | propylene carbonate,1,2-propylene carbonate,1,2-propanediol cyclic carbonate,texacar pc,1,3-dioxolan-2-one, 4-methyl,cyclic propylene carbonate,arconate 5000,1,2-propanediol carbonate,1-methylethylene carbonate,cyclic 1,2-propylene carbonate |
| IUPAC Name | 4-methyl-1,3-dioxolan-2-one |
| InChI Key | RUOJZAUFBMNUDX-UHFFFAOYNA-N |
| Molecular Formula | C4H6O3 |
Ethylenediaminetetraacetic acid disodium salt dihydrate, ACS, 99.0-101.0%
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium;2-[2-[bis(carboxymethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
2,2'-Bipyridine, 99+%
CAS: 366-18-7 Molecular Formula: C10H8N2 Molecular Weight (g/mol): 156.19 MDL Number: MFCD00006212 InChI Key: ROFVEXUMMXZLPA-UHFFFAOYSA-N Synonym: 2,2'-bipyridine,2,2'-dipyridyl,2,2'-bipyridyl,bipyridine,2,2'-dipyridine,2-2-pyridyl pyridine,2,2'-bipyridin,alpha,alpha'-dipyridyl,alpha,alpha'-bipyridyl,2,2-bipyridyl PubChem CID: 1474 ChEBI: CHEBI:30351 SMILES: C1=CC=C(N=C1)C1=CC=CC=N1
| PubChem CID | 1474 |
|---|---|
| CAS | 366-18-7 |
| Molecular Weight (g/mol) | 156.19 |
| ChEBI | CHEBI:30351 |
| MDL Number | MFCD00006212 |
| SMILES | C1=CC=C(N=C1)C1=CC=CC=N1 |
| Synonym | 2,2'-bipyridine,2,2'-dipyridyl,2,2'-bipyridyl,bipyridine,2,2'-dipyridine,2-2-pyridyl pyridine,2,2'-bipyridin,alpha,alpha'-dipyridyl,alpha,alpha'-bipyridyl,2,2-bipyridyl |
| InChI Key | ROFVEXUMMXZLPA-UHFFFAOYSA-N |
| Molecular Formula | C10H8N2 |
N-Lauroylsarcosine sodium salt, 95%
CAS: 137-16-6 Molecular Formula: C15H28NNaO3 Molecular Weight (g/mol): 293.38 MDL Number: MFCD00042728 InChI Key: KSAVQLQVUXSOCR-UHFFFAOYSA-M Synonym: sarkosyl nl,sodium lauroyl sarcosinate,n-lauroylsarcosine sodium salt,sodium n-lauroylsarcosinate,sodium lauroylsarcosinate,sarcosyl nl,maprosyl 30,compound 105,gardol,hamposyl l-30 PubChem CID: 23668817 IUPAC Name: sodium;2-[dodecanoyl(methyl)amino]acetate SMILES: [Na+].CCCCCCCCCCCC(=O)N(C)CC([O-])=O
| PubChem CID | 23668817 |
|---|---|
| CAS | 137-16-6 |
| Molecular Weight (g/mol) | 293.38 |
| MDL Number | MFCD00042728 |
| SMILES | [Na+].CCCCCCCCCCCC(=O)N(C)CC([O-])=O |
| Synonym | sarkosyl nl,sodium lauroyl sarcosinate,n-lauroylsarcosine sodium salt,sodium n-lauroylsarcosinate,sodium lauroylsarcosinate,sarcosyl nl,maprosyl 30,compound 105,gardol,hamposyl l-30 |
| IUPAC Name | sodium;2-[dodecanoyl(methyl)amino]acetate |
| InChI Key | KSAVQLQVUXSOCR-UHFFFAOYSA-M |
| Molecular Formula | C15H28NNaO3 |
N-(1-Naphthyl)ethylenediamine dihydrochloride, 96%
CAS: 1465-25-4 Molecular Formula: C12H16Cl2N2 Molecular Weight (g/mol): 259.174 MDL Number: MFCD00012556 InChI Key: MZNYWPRCVDMOJG-UHFFFAOYSA-N Synonym: n-1-naphthyl ethylenediamine dihydrochloride,n1-naphthalen-1-yl ethane-1,2-diamine dihydrochloride,marshall's reagent,n-1-naphthylethylenediamine dihydrochloride,ccris 425,unii-h734599kjl,1,2-ethanediamine, n-1-naphthalenyl-, dihydrochloride,2-1-naphthylamino ethylamine 2hcl,bratton-marshall reagent,n-1-naphthalenyl-1,2-ethanediamine dihydrochloride PubChem CID: 15106 ChEBI: CHEBI:53452 IUPAC Name: N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride SMILES: C1=CC=C2C(=C1)C=CC=C2NCCN.Cl.Cl
| PubChem CID | 15106 |
|---|---|
| CAS | 1465-25-4 |
| Molecular Weight (g/mol) | 259.174 |
| ChEBI | CHEBI:53452 |
| MDL Number | MFCD00012556 |
| SMILES | C1=CC=C2C(=C1)C=CC=C2NCCN.Cl.Cl |
| Synonym | n-1-naphthyl ethylenediamine dihydrochloride,n1-naphthalen-1-yl ethane-1,2-diamine dihydrochloride,marshall's reagent,n-1-naphthylethylenediamine dihydrochloride,ccris 425,unii-h734599kjl,1,2-ethanediamine, n-1-naphthalenyl-, dihydrochloride,2-1-naphthylamino ethylamine 2hcl,bratton-marshall reagent,n-1-naphthalenyl-1,2-ethanediamine dihydrochloride |
| IUPAC Name | N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride |
| InChI Key | MZNYWPRCVDMOJG-UHFFFAOYSA-N |
| Molecular Formula | C12H16Cl2N2 |
Thermo Scientific Chemicals Metronidazole, 99%
CAS: 443-48-1 Molecular Formula: C6H9N3O3 Molecular Weight (g/mol): 171.16 MDL Number: MFCD00009750 InChI Key: VAOCPAMSLUNLGC-UHFFFAOYSA-N Synonym: metronidazole,metronidazol,flagyl,2-methyl-5-nitroimidazole-1-ethanol,anagiardil,trichazol,gineflavir,meronidal,metronidaz,novonidazol PubChem CID: 4173 ChEBI: CHEBI:6909 IUPAC Name: 2-(2-methyl-5-nitroimidazol-1-yl)ethanol SMILES: CC1=NC=C(N1CCO)[N+](=O)[O-]
| PubChem CID | 4173 |
|---|---|
| CAS | 443-48-1 |
| Molecular Weight (g/mol) | 171.16 |
| ChEBI | CHEBI:6909 |
| MDL Number | MFCD00009750 |
| SMILES | CC1=NC=C(N1CCO)[N+](=O)[O-] |
| Synonym | metronidazole,metronidazol,flagyl,2-methyl-5-nitroimidazole-1-ethanol,anagiardil,trichazol,gineflavir,meronidal,metronidaz,novonidazol |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethanol |
| InChI Key | VAOCPAMSLUNLGC-UHFFFAOYSA-N |
| Molecular Formula | C6H9N3O3 |
2,5-Bis(5-tert-butyl-2-benzoxazolyl)thiophene, 99%
CAS: 7128-64-5 Molecular Formula: C26H26N2O2S Molecular Weight (g/mol): 430.566 MDL Number: MFCD00005774 InChI Key: AIXZBGVLNVRQSS-UHFFFAOYSA-N Synonym: bbot,2,5-bis 5-tert-butyl-2-benzoxazolyl thiophene,uvitex ob,2,5-bis 5-tert-butyl benzo d oxazol-2-yl thiophene,bbot 150,2,5-bis 5-tert-butylbenzoxazol-2-yl thiophene,benzoxazole, 2,2'-2,5-thiophenediyl bis 5-1,1-dimethylethyl,unii-w7ur9129gp,fluorescent brightener 184,2,2'-2,5-thiophenediyl bis 5-tert-butylbenzoxazole PubChem CID: 292429 IUPAC Name: 5-tert-butyl-2-[5-(5-tert-butyl-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazole SMILES: CC(C)(C)C1=CC2=C(C=C1)OC(=N2)C3=CC=C(S3)C4=NC5=C(O4)C=CC(=C5)C(C)(C)C
| PubChem CID | 292429 |
|---|---|
| CAS | 7128-64-5 |
| Molecular Weight (g/mol) | 430.566 |
| MDL Number | MFCD00005774 |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)OC(=N2)C3=CC=C(S3)C4=NC5=C(O4)C=CC(=C5)C(C)(C)C |
| Synonym | bbot,2,5-bis 5-tert-butyl-2-benzoxazolyl thiophene,uvitex ob,2,5-bis 5-tert-butyl benzo d oxazol-2-yl thiophene,bbot 150,2,5-bis 5-tert-butylbenzoxazol-2-yl thiophene,benzoxazole, 2,2'-2,5-thiophenediyl bis 5-1,1-dimethylethyl,unii-w7ur9129gp,fluorescent brightener 184,2,2'-2,5-thiophenediyl bis 5-tert-butylbenzoxazole |
| IUPAC Name | 5-tert-butyl-2-[5-(5-tert-butyl-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazole |
| InChI Key | AIXZBGVLNVRQSS-UHFFFAOYSA-N |
| Molecular Formula | C26H26N2O2S |
Diphenyl ether, 99%
CAS: 101-84-8 Molecular Formula: C12H10O Molecular Weight (g/mol): 170.211 MDL Number: MFCD00003034 InChI Key: USIUVYZYUHIAEV-UHFFFAOYSA-N Synonym: diphenyl ether,diphenyl oxide,phenyl ether,oxydibenzene,phenyl oxide,oxybisbenzene,biphenyl oxide,1,1'-oxydibenzene,benzene, 1,1'-oxybis,oxydiphenyl PubChem CID: 7583 ChEBI: CHEBI:39258 IUPAC Name: phenoxybenzene SMILES: C1=CC=C(C=C1)OC2=CC=CC=C2
| PubChem CID | 7583 |
|---|---|
| CAS | 101-84-8 |
| Molecular Weight (g/mol) | 170.211 |
| ChEBI | CHEBI:39258 |
| MDL Number | MFCD00003034 |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2 |
| Synonym | diphenyl ether,diphenyl oxide,phenyl ether,oxydibenzene,phenyl oxide,oxybisbenzene,biphenyl oxide,1,1'-oxydibenzene,benzene, 1,1'-oxybis,oxydiphenyl |
| IUPAC Name | phenoxybenzene |
| InChI Key | USIUVYZYUHIAEV-UHFFFAOYSA-N |
| Molecular Formula | C12H10O |
Triethylamine, HPLC, >99.5%, MilliporeSigma™
CAS: 121-44-8 Molecular Formula: C6H15N Molecular Weight (g/mol): 101.19 InChI Key: ZMANZCXQSJIPKH-UHFFFAOYSA-N Synonym: triethylamine,ethanamine, n,n-diethyl,diethylamino ethane,triaethylamin,triethylamin,triethyl amine,trietilamina,n,n,n-triethylamine,net3,diethylaminoethane PubChem CID: 8471 ChEBI: CHEBI:35026
| PubChem CID | 8471 |
|---|---|
| CAS | 121-44-8 |
| Molecular Weight (g/mol) | 101.19 |
| ChEBI | CHEBI:35026 |
| Synonym | triethylamine,ethanamine, n,n-diethyl,diethylamino ethane,triaethylamin,triethylamin,triethyl amine,trietilamina,n,n,n-triethylamine,net3,diethylaminoethane |
| InChI Key | ZMANZCXQSJIPKH-UHFFFAOYSA-N |
| Molecular Formula | C6H15N |
Spermidine trihydrochloride, 99+%
CAS: 334-50-9 Molecular Formula: C7H22Cl3N3 Molecular Weight (g/mol): 254.62 MDL Number: MFCD00012918 InChI Key: LCNBIHVSOPXFMR-UHFFFAOYSA-N Synonym: spermidine trihydrochloride,n-3-aminopropyl-1,4-butanediamine trihydrochloride,spermidine hydrochloride,n1-3-aminopropyl butane-1,4-diamine trihydrochloride,unii-1o14bed398,1,4-butanediamine, n-3-aminopropyl-, trihydrochloride,spermidine, trihydrochloride,1,4-butanediamine, n-3-aminopropyl , hydrochloride,n-3-aminopropyl butane-1,4-diamine trihydrochloride,4-azoniaoctamethylenediammonium trichloride PubChem CID: 9539 IUPAC Name: N'-(3-aminopropyl)butane-1,4-diamine;trihydrochloride SMILES: [H+].[H+].[H+].[Cl-].[Cl-].[Cl-].NCCCCNCCCN
| PubChem CID | 9539 |
|---|---|
| CAS | 334-50-9 |
| Molecular Weight (g/mol) | 254.62 |
| MDL Number | MFCD00012918 |
| SMILES | [H+].[H+].[H+].[Cl-].[Cl-].[Cl-].NCCCCNCCCN |
| Synonym | spermidine trihydrochloride,n-3-aminopropyl-1,4-butanediamine trihydrochloride,spermidine hydrochloride,n1-3-aminopropyl butane-1,4-diamine trihydrochloride,unii-1o14bed398,1,4-butanediamine, n-3-aminopropyl-, trihydrochloride,spermidine, trihydrochloride,1,4-butanediamine, n-3-aminopropyl , hydrochloride,n-3-aminopropyl butane-1,4-diamine trihydrochloride,4-azoniaoctamethylenediammonium trichloride |
| IUPAC Name | N'-(3-aminopropyl)butane-1,4-diamine;trihydrochloride |
| InChI Key | LCNBIHVSOPXFMR-UHFFFAOYSA-N |
| Molecular Formula | C7H22Cl3N3 |
Mesitylene, 98+%
CAS: 108-67-8 Molecular Formula: C9H12 Molecular Weight (g/mol): 120.195 MDL Number: MFCD00008538 InChI Key: AUHZEENZYGFFBQ-UHFFFAOYSA-N Synonym: mesitylene,sym-trimethylbenzene,benzene, 1,3,5-trimethyl,fleet-x,trimethylbenzol,3,5-dimethyltoluene,s-trimethylbenzene,hsdb 92,2,4,6-trimethylbenzene,1,3,5-trimethyl-benzene PubChem CID: 7947 ChEBI: CHEBI:34833 IUPAC Name: 1,3,5-trimethylbenzene SMILES: CC1=CC(=CC(=C1)C)C
| PubChem CID | 7947 |
|---|---|
| CAS | 108-67-8 |
| Molecular Weight (g/mol) | 120.195 |
| ChEBI | CHEBI:34833 |
| MDL Number | MFCD00008538 |
| SMILES | CC1=CC(=CC(=C1)C)C |
| Synonym | mesitylene,sym-trimethylbenzene,benzene, 1,3,5-trimethyl,fleet-x,trimethylbenzol,3,5-dimethyltoluene,s-trimethylbenzene,hsdb 92,2,4,6-trimethylbenzene,1,3,5-trimethyl-benzene |
| IUPAC Name | 1,3,5-trimethylbenzene |
| InChI Key | AUHZEENZYGFFBQ-UHFFFAOYSA-N |
| Molecular Formula | C9H12 |
Morpholine, 99+%, extra pure
CAS: 110-91-8 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00005972 InChI Key: YNAVUWVOSKDBBP-UHFFFAOYSA-N Synonym: 1-oxa-4-azacyclohexane,tetrahydro-1,4-oxazine,diethylene oximide,diethylenimide oxide,diethyleneimide oxide,drewamine,diethylene imidoxide,tetrahydro-p-oxazine,tetrahydro-2h-1,4-oxazine,p-isoxazine, tetrahydro PubChem CID: 8083 ChEBI: CHEBI:34856 IUPAC Name: morpholine SMILES: C1COCCN1
| PubChem CID | 8083 |
|---|---|
| CAS | 110-91-8 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:34856 |
| MDL Number | MFCD00005972 |
| SMILES | C1COCCN1 |
| Synonym | 1-oxa-4-azacyclohexane,tetrahydro-1,4-oxazine,diethylene oximide,diethylenimide oxide,diethyleneimide oxide,drewamine,diethylene imidoxide,tetrahydro-p-oxazine,tetrahydro-2h-1,4-oxazine,p-isoxazine, tetrahydro |
| IUPAC Name | morpholine |
| InChI Key | YNAVUWVOSKDBBP-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
Isoamyl Alcohol, MP Biomedicals™
CAS: 123-51-3 Molecular Formula: C5H12O Molecular Weight (g/mol): 88.15 InChI Key: PHTQWCKDNZKARW-UHFFFAOYSA-N Synonym: 3-methyl-1-butanol,isoamyl alcohol,isopentyl alcohol,isopentanol,3-methylbutanol,1-butanol, 3-methyl,isoamylol,isobutylcarbinol,iso-amylalkohol,isobutyl carbinol PubChem CID: 31260 ChEBI: CHEBI:15837 IUPAC Name: 3-methylbutan-1-ol SMILES: CC(C)CCO
| PubChem CID | 31260 |
|---|---|
| CAS | 123-51-3 |
| Molecular Weight (g/mol) | 88.15 |
| ChEBI | CHEBI:15837 |
| SMILES | CC(C)CCO |
| Synonym | 3-methyl-1-butanol,isoamyl alcohol,isopentyl alcohol,isopentanol,3-methylbutanol,1-butanol, 3-methyl,isoamylol,isobutylcarbinol,iso-amylalkohol,isobutyl carbinol |
| IUPAC Name | 3-methylbutan-1-ol |
| InChI Key | PHTQWCKDNZKARW-UHFFFAOYSA-N |
| Molecular Formula | C5H12O |
2-Butoxyethanol, 99%, extra pure
CAS: 111-76-2 Molecular Formula: C6H14O2 Molecular Weight (g/mol): 118.18 MDL Number: MFCD00002884 InChI Key: POAOYUHQDCAZBD-UHFFFAOYSA-N Synonym: butoxyethanol,butyl glycol,butyl cellosolve,ethylene glycol monobutyl ether,n-butoxyethanol,ethanol, 2-butoxy,ethylene glycol butyl ether,butyl oxitol,glycol butyl ether,glycol ether eb PubChem CID: 8133 ChEBI: CHEBI:63921 SMILES: CCCCOCCO
| PubChem CID | 8133 |
|---|---|
| CAS | 111-76-2 |
| Molecular Weight (g/mol) | 118.18 |
| ChEBI | CHEBI:63921 |
| MDL Number | MFCD00002884 |
| SMILES | CCCCOCCO |
| Synonym | butoxyethanol,butyl glycol,butyl cellosolve,ethylene glycol monobutyl ether,n-butoxyethanol,ethanol, 2-butoxy,ethylene glycol butyl ether,butyl oxitol,glycol butyl ether,glycol ether eb |
| InChI Key | POAOYUHQDCAZBD-UHFFFAOYSA-N |
| Molecular Formula | C6H14O2 |